C21H21FN2O4 — CID 108543479
[3-[4-(2-fluorobenzoyl)-1,4-diazepane-1-carbonyl]phenyl] acetate (PubChem CID 108543479) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is [3-[4-(2-fluorobenzoyl)-1,4-diazepane-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-(2-fluorobenzoyl)-1,4-diazepane-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108543479 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [3-[4-(2-fluorobenzoyl)-1,4-diazepane-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCCN(C(=O)c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C21H21FN2O4/c1-15(25)28-17-7-4-6-16(14-17)20(26)23-10-5-11-24(13-12-23)21(27)18-8-2-3-9-19(18)22/h2-4,6-9,14H,5,10-13H2,1H3 |
| InChIKey | WKVLFKFRTMAMIC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|