C13H20N3O3S+ — CID 7029961
N-[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]methanesulfonamide (PubChem CID 7029961) has the molecular formula C13H20N3O3S+ and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 7029961 |
| Molecular Formula | C13H20N3O3S+ |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-[4-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]methanesulfonamide |
| SMILES | C[NH+]1CCN(C(=O)c2ccc(NS(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C13H19N3O3S/c1-15-7-9-16(10-8-15)13(17)11-3-5-12(6-4-11)14-20(2,18)19/h3-6,14H,7-10H2,1-2H3/p+1 |
| InChIKey | FPULDDIOQDOFQI-UHFFFAOYSA-O |
| XLogP | -0.97 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |