C16H21N3O5S — CID 108568479
prop-2-enyl 4-[4-(methanesulfonamido)benzoyl]piperazine-1-carboxylate (PubChem CID 108568479) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is prop-2-enyl 4-[4-(methanesulfonamido)benzoyl]piperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[4-(methanesulfonamido)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108568479 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | prop-2-enyl 4-[4-(methanesulfonamido)benzoyl]piperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN(C(=O)c2ccc(NS(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C16H21N3O5S/c1-3-12-24-16(21)19-10-8-18(9-11-19)15(20)13-4-6-14(7-5-13)17-25(2,22)23/h3-7,17H,1,8-12H2,2H3 |
| InChIKey | KRYHOXWKWCWLFH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|