C14H22N4O5S2 — CID 108568463
4-[4-(methanesulfonamido)benzoyl]-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 108568463) has the molecular formula C14H22N4O5S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-[4-(methanesulfonamido)benzoyl]-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-[4-(methanesulfonamido)benzoyl]-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 108568463 |
| Molecular Formula | C14H22N4O5S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-[4-(methanesulfonamido)benzoyl]-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)c2ccc(NS(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C14H22N4O5S2/c1-16(2)25(22,23)18-10-8-17(9-11-18)14(19)12-4-6-13(7-5-12)15-24(3,20)21/h4-7,15H,8-11H2,1-3H3 |
| InChIKey | SNXSGUFUSACILL-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |