C11H17N3O3S2 — CID 32503634
N,N-dimethyl-4-(thiophene-3-carbonyl)piperazine-1-sulfonamide (PubChem CID 32503634) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N,N-dimethyl-4-(thiophene-3-carbonyl)piperazine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(thiophene-3-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 32503634 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N,N-dimethyl-4-(thiophene-3-carbonyl)piperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C11H17N3O3S2/c1-12(2)19(16,17)14-6-4-13(5-7-14)11(15)10-3-8-18-9-10/h3,8-9H,4-7H2,1-2H3 |
| InChIKey | MFAOAWXEQCYKFF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |