C13H19N3O5S — CID 108570154
4-(3,5-dihydroxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 108570154) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-(3,5-dihydroxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-(3,5-dihydroxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 108570154 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-(3,5-dihydroxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C13H19N3O5S/c1-14(2)22(20,21)16-5-3-15(4-6-16)13(19)10-7-11(17)9-12(18)8-10/h7-9,17-18H,3-6H2,1-2H3 |
| InChIKey | BHVOGXAFYWMWLJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |