C15H14F2N2O3S2 — CID 17485336
[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-thiophen-3-ylmethanone (PubChem CID 17485336) has the molecular formula C15H14F2N2O3S2 and a molecular weight of 372.42 g/mol. Its IUPAC name is [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 17485336 |
| Molecular Formula | C15H14F2N2O3S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C15H14F2N2O3S2/c16-12-2-1-3-13(17)14(12)24(21,22)19-7-5-18(6-8-19)15(20)11-4-9-23-10-11/h1-4,9-10H,5-8H2 |
| InChIKey | VQTIYGNOXIEUQQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |