C19H16F2N4O5S — CID 166185922
6-[4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 166185922) has the molecular formula C19H16F2N4O5S and a molecular weight of 450.42 g/mol. Its IUPAC name is 6-[4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 166185922 |
| Molecular Formula | C19H16F2N4O5S |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 6-[4-(2,6-difluorophenyl)sulfonylpiperazine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=C(c1ccc2[nH]c(=O)c(=O)[nH]c2c1)N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H16F2N4O5S/c20-12-2-1-3-13(21)16(12)31(29,30)25-8-6-24(7-9-25)19(28)11-4-5-14-15(10-11)23-18(27)17(26)22-14/h1-5,10H,6-9H2,(H,22,26)(H,23,27) |
| InChIKey | HUOYWSSROGTOLK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|