C25H30N4O5S — CID 38072730
4-ethyl-7-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbonyl]-1H-quinoxaline-2,3-dione (PubChem CID 38072730) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 4-ethyl-7-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbonyl]-1H-quinoxaline-2,3-dione.
| Compound Name | 4-ethyl-7-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbonyl]-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 38072730 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-ethyl-7-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbonyl]-1H-quinoxaline-2,3-dione |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N3CCN(S(=O)(=O)c4c(C)c(C)cc(C)c4C)CC3)ccc21 |
| InChI | InChI=1S/C25H30N4O5S/c1-6-29-21-8-7-19(14-20(21)26-23(30)25(29)32)24(31)27-9-11-28(12-10-27)35(33,34)22-17(4)15(2)13-16(3)18(22)5/h7-8,13-14H,6,9-12H2,1-5H3,(H,26,30) |
| InChIKey | RPHUULLJMYUAQN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|