C19H26ClN5O3 — CID 120997842
4-ethyl-7-(3-piperazin-1-ylpyrrolidine-1-carbonyl)-1H-quinoxaline-2,3-dione;hydrochloride (PubChem CID 120997842) has the molecular formula C19H26ClN5O3 and a molecular weight of 407.90 g/mol. Its IUPAC name is 4-ethyl-7-(3-piperazin-1-ylpyrrolidine-1-carbonyl)-1H-quinoxaline-2,3-dione;hydrochloride.
| Compound Name | 4-ethyl-7-(3-piperazin-1-ylpyrrolidine-1-carbonyl)-1H-quinoxaline-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 120997842 |
| Molecular Formula | C19H26ClN5O3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-ethyl-7-(3-piperazin-1-ylpyrrolidine-1-carbonyl)-1H-quinoxaline-2,3-dione;hydrochloride |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N3CCC(N4CCNCC4)C3)ccc21.Cl |
| InChI | InChI=1S/C19H25N5O3.ClH/c1-2-24-16-4-3-13(11-15(16)21-17(25)19(24)27)18(26)23-8-5-14(12-23)22-9-6-20-7-10-22;/h3-4,11,14,20H,2,5-10,12H2,1H3,(H,21,25);1H |
| InChIKey | KMZJZQYUQRLIHR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|