C17H24ClN5O3 — CID 119447949
1-ethyl-2,3-dioxo-N-(2-piperazin-1-ylethyl)-4H-quinoxaline-6-carboxamide;hydrochloride (PubChem CID 119447949) has the molecular formula C17H24ClN5O3 and a molecular weight of 381.86 g/mol. Its IUPAC name is 1-ethyl-2,3-dioxo-N-(2-piperazin-1-ylethyl)-4H-quinoxaline-6-carboxamide;hydrochloride.
| Compound Name | 1-ethyl-2,3-dioxo-N-(2-piperazin-1-ylethyl)-4H-quinoxaline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119447949 |
| Molecular Formula | C17H24ClN5O3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-ethyl-2,3-dioxo-N-(2-piperazin-1-ylethyl)-4H-quinoxaline-6-carboxamide;hydrochloride |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NCCN3CCNCC3)ccc21.Cl |
| InChI | InChI=1S/C17H23N5O3.ClH/c1-2-22-14-4-3-12(11-13(14)20-16(24)17(22)25)15(23)19-7-10-21-8-5-18-6-9-21;/h3-4,11,18H,2,5-10H2,1H3,(H,19,23)(H,20,24);1H |
| InChIKey | PTWVTJQFRFQIOT-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|