C15H19N3O3 — CID 2557057
N-[(2S)-butan-2-yl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 2557057) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 2557057 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[(2S)-butan-2-yl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CC[C@H](C)NC(=O)c1ccc2c(c1)[nH]c(=O)c(=O)n2CC |
| InChI | InChI=1S/C15H19N3O3/c1-4-9(3)16-13(19)10-6-7-12-11(8-10)17-14(20)15(21)18(12)5-2/h6-9H,4-5H2,1-3H3,(H,16,19)(H,17,20)/t9-/m0/s1 |
| InChIKey | PBVFSXWRMFGTRT-VIFPVBQESA-N |
| XLogP | 1.24 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|