C17H25ClN4O3 — CID 119607970
N-(1-amino-2,3-dimethylbutan-2-yl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide;hydrochloride (PubChem CID 119607970) has the molecular formula C17H25ClN4O3 and a molecular weight of 368.87 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119607970 |
| Molecular Formula | C17H25ClN4O3 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide;hydrochloride |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NC(C)(CN)C(C)C)ccc21.Cl |
| InChI | InChI=1S/C17H24N4O3.ClH/c1-5-21-13-7-6-11(8-12(13)19-15(23)16(21)24)14(22)20-17(4,9-18)10(2)3;/h6-8,10H,5,9,18H2,1-4H3,(H,19,23)(H,20,22);1H |
| InChIKey | ZQFPGZXYPGXRNS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|