C21H23FN4O3 — CID 2813010
2-[1-[4-(dimethylamino)benzoyl]-3-oxopiperazin-2-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 2813010) has the molecular formula C21H23FN4O3 and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-[1-[4-(dimethylamino)benzoyl]-3-oxopiperazin-2-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[1-[4-(dimethylamino)benzoyl]-3-oxopiperazin-2-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2813010 |
| Molecular Formula | C21H23FN4O3 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[1-[4-(dimethylamino)benzoyl]-3-oxopiperazin-2-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CN(C)c1ccc(C(=O)N2CCNC(=O)C2CC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H23FN4O3/c1-25(2)17-9-3-14(4-10-17)21(29)26-12-11-23-20(28)18(26)13-19(27)24-16-7-5-15(22)6-8-16/h3-10,18H,11-13H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | OZXGJDCZFFKIFV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |