C18H25ClN4O3 — CID 119558159
1-ethyl-2,3-dioxo-N-(2-piperidin-3-ylethyl)-4H-quinoxaline-6-carboxamide;hydrochloride (PubChem CID 119558159) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is 1-ethyl-2,3-dioxo-N-(2-piperidin-3-ylethyl)-4H-quinoxaline-6-carboxamide;hydrochloride.
| Compound Name | 1-ethyl-2,3-dioxo-N-(2-piperidin-3-ylethyl)-4H-quinoxaline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119558159 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-ethyl-2,3-dioxo-N-(2-piperidin-3-ylethyl)-4H-quinoxaline-6-carboxamide;hydrochloride |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NCCC3CCCNC3)ccc21.Cl |
| InChI | InChI=1S/C18H24N4O3.ClH/c1-2-22-15-6-5-13(10-14(15)21-17(24)18(22)25)16(23)20-9-7-12-4-3-8-19-11-12;/h5-6,10,12,19H,2-4,7-9,11H2,1H3,(H,20,23)(H,21,24);1H |
| InChIKey | MEXLNECVDXYLLC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|