C19H25N5O4 — CID 119481479
N-(2-aminoethyl)-1-(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)piperidine-3-carboxamide (PubChem CID 119481479) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119481479 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(2-aminoethyl)-1-(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)piperidine-3-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N3CCCC(C(=O)NCCN)C3)ccc21 |
| InChI | InChI=1S/C19H25N5O4/c1-2-24-15-6-5-12(10-14(15)22-17(26)19(24)28)18(27)23-9-3-4-13(11-23)16(25)21-8-7-20/h5-6,10,13H,2-4,7-9,11,20H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | UKGAVKMHGHDUMC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|