C17H23ClN4O3 — CID 119423703
7-[4-(aminomethyl)piperidine-1-carbonyl]-4-ethyl-1H-quinoxaline-2,3-dione;hydrochloride (PubChem CID 119423703) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is 7-[4-(aminomethyl)piperidine-1-carbonyl]-4-ethyl-1H-quinoxaline-2,3-dione;hydrochloride.
| Compound Name | 7-[4-(aminomethyl)piperidine-1-carbonyl]-4-ethyl-1H-quinoxaline-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119423703 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 7-[4-(aminomethyl)piperidine-1-carbonyl]-4-ethyl-1H-quinoxaline-2,3-dione;hydrochloride |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N3CCC(CN)CC3)ccc21.Cl |
| InChI | InChI=1S/C17H22N4O3.ClH/c1-2-21-14-4-3-12(9-13(14)19-15(22)17(21)24)16(23)20-7-5-11(10-18)6-8-20;/h3-4,9,11H,2,5-8,10,18H2,1H3,(H,19,22);1H |
| InChIKey | QOZYFWARQNOYOU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|