C21H20F3N5O3 — CID 26661546
4-ethyl-7-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]-1H-quinoxaline-2,3-dione (PubChem CID 26661546) has the molecular formula C21H20F3N5O3 and a molecular weight of 447.42 g/mol. Its IUPAC name is 4-ethyl-7-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]-1H-quinoxaline-2,3-dione.
| Compound Name | 4-ethyl-7-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 26661546 |
| Molecular Formula | C21H20F3N5O3 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-ethyl-7-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbonyl]-1H-quinoxaline-2,3-dione |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N3CCN(c4ccc(C(F)(F)F)cn4)CC3)ccc21 |
| InChI | InChI=1S/C21H20F3N5O3/c1-2-29-16-5-3-13(11-15(16)26-18(30)20(29)32)19(31)28-9-7-27(8-10-28)17-6-4-14(12-25-17)21(22,23)24/h3-6,11-12H,2,7-10H2,1H3,(H,26,30) |
| InChIKey | LWZKZYQIAUPBIW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|