C14H15N3O5 — CID 119346233
2-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]acetic acid (PubChem CID 119346233) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]acetic acid.
| Compound Name | 2-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 119346233 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]acetic acid |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N(C)CC(=O)O)ccc21 |
| InChI | InChI=1S/C14H15N3O5/c1-3-17-10-5-4-8(13(21)16(2)7-11(18)19)6-9(10)15-12(20)14(17)22/h4-6H,3,7H2,1-2H3,(H,15,20)(H,18,19) |
| InChIKey | KEGVEOPFDAWTTN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|