C17H21N3O5 — CID 119357294
4-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 119357294) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119357294 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NC(C)(C)CCC(=O)O)ccc21 |
| InChI | InChI=1S/C17H21N3O5/c1-4-20-12-6-5-10(9-11(12)18-15(24)16(20)25)14(23)19-17(2,3)8-7-13(21)22/h5-6,9H,4,7-8H2,1-3H3,(H,18,24)(H,19,23)(H,21,22) |
| InChIKey | CPEXFMKPGVHYPN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|