C21H27ClN4O — CID 120997391
(3-anilinophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 120997391) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is (3-anilinophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (3-anilinophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120997391 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (3-anilinophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cccc(Nc2ccccc2)c1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C21H26N4O.ClH/c26-21(25-12-9-20(16-25)24-13-10-22-11-14-24)17-5-4-8-19(15-17)23-18-6-2-1-3-7-18;/h1-8,15,20,22-23H,9-14,16H2;1H |
| InChIKey | DFDLYWSKOZWWFZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |