C22H33ClN4O2 — CID 120995374
N-[3-(3-piperazin-1-ylpyrrolidine-1-carbonyl)phenyl]cyclohexanecarboxamide;hydrochloride (PubChem CID 120995374) has the molecular formula C22H33ClN4O2 and a molecular weight of 420.99 g/mol. Its IUPAC name is N-[3-(3-piperazin-1-ylpyrrolidine-1-carbonyl)phenyl]cyclohexanecarboxamide;hydrochloride.
| Compound Name | N-[3-(3-piperazin-1-ylpyrrolidine-1-carbonyl)phenyl]cyclohexanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 120995374 |
| Molecular Formula | C22H33ClN4O2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[3-(3-piperazin-1-ylpyrrolidine-1-carbonyl)phenyl]cyclohexanecarboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(C(=O)N2CCC(N3CCNCC3)C2)c1)C1CCCCC1 |
| InChI | InChI=1S/C22H32N4O2.ClH/c27-21(17-5-2-1-3-6-17)24-19-8-4-7-18(15-19)22(28)26-12-9-20(16-26)25-13-10-23-11-14-25;/h4,7-8,15,17,20,23H,1-3,5-6,9-14,16H2,(H,24,27);1H |
| InChIKey | AZLSCFLWRWZOKN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |