C19H23ClN6O3 — CID 120878107
4-ethyl-7-[2-(1-methylimidazol-2-yl)piperazine-1-carbonyl]-1H-quinoxaline-2,3-dione;hydrochloride (PubChem CID 120878107) has the molecular formula C19H23ClN6O3 and a molecular weight of 418.89 g/mol. Its IUPAC name is 4-ethyl-7-[2-(1-methylimidazol-2-yl)piperazine-1-carbonyl]-1H-quinoxaline-2,3-dione;hydrochloride.
| Compound Name | 4-ethyl-7-[2-(1-methylimidazol-2-yl)piperazine-1-carbonyl]-1H-quinoxaline-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 120878107 |
| Molecular Formula | C19H23ClN6O3 |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-ethyl-7-[2-(1-methylimidazol-2-yl)piperazine-1-carbonyl]-1H-quinoxaline-2,3-dione;hydrochloride |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N3CCNCC3c3nccn3C)ccc21.Cl |
| InChI | InChI=1S/C19H22N6O3.ClH/c1-3-24-14-5-4-12(10-13(14)22-17(26)19(24)28)18(27)25-9-6-20-11-15(25)16-21-7-8-23(16)2;/h4-5,7-8,10,15,20H,3,6,9,11H2,1-2H3,(H,22,26);1H |
| InChIKey | HWNQQYQNJDCULY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|