C16H20N4O3S — CID 120880628
[2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-methylsulfonylphenyl)methanone (PubChem CID 120880628) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-methylsulfonylphenyl)methanone.
| Compound Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 120880628 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-methylsulfonylphenyl)methanone |
| SMILES | Cn1ccnc1C1CNCCN1C(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H20N4O3S/c1-19-8-7-18-15(19)14-11-17-6-9-20(14)16(21)12-4-3-5-13(10-12)24(2,22)23/h3-5,7-8,10,14,17H,6,9,11H2,1-2H3 |
| InChIKey | DMXYGTPMFDLTNT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |