C14H20ClN5O — CID 120879273
[2-(1-methylimidazol-2-yl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride (PubChem CID 120879273) has the molecular formula C14H20ClN5O and a molecular weight of 309.80 g/mol. Its IUPAC name is [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride.
| Compound Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120879273 |
| Molecular Formula | C14H20ClN5O |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride |
| SMILES | Cl.Cn1cccc1C(=O)N1CCNCC1c1nccn1C |
| InChI | InChI=1S/C14H19N5O.ClH/c1-17-7-3-4-11(17)14(20)19-9-5-15-10-12(19)13-16-6-8-18(13)2;/h3-4,6-8,12,15H,5,9-10H2,1-2H3;1H |
| InChIKey | QSOPJXJSBDBFGI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |