C13H18ClN5O — CID 120878125
[2-(1-methylimidazol-2-yl)piperazin-1-yl]-(1H-pyrrol-2-yl)methanone;hydrochloride (PubChem CID 120878125) has the molecular formula C13H18ClN5O and a molecular weight of 295.77 g/mol. Its IUPAC name is [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(1H-pyrrol-2-yl)methanone;hydrochloride.
| Compound Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(1H-pyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120878125 |
| Molecular Formula | C13H18ClN5O |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(1H-pyrrol-2-yl)methanone;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C13H17N5O.ClH/c1-17-7-6-16-12(17)11-9-14-5-8-18(11)13(19)10-3-2-4-15-10;/h2-4,6-7,11,14-15H,5,8-9H2,1H3;1H |
| InChIKey | UBWRUDGPYWCKSA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |