C13H17ClN6O3 — CID 120880809
[2-(1-methylimidazol-2-yl)piperazin-1-yl]-(5-nitro-1H-pyrrol-2-yl)methanone;hydrochloride (PubChem CID 120880809) has the molecular formula C13H17ClN6O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(5-nitro-1H-pyrrol-2-yl)methanone;hydrochloride.
| Compound Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(5-nitro-1H-pyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120880809 |
| Molecular Formula | C13H17ClN6O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(5-nitro-1H-pyrrol-2-yl)methanone;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1C(=O)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C13H16N6O3.ClH/c1-17-6-5-15-12(17)10-8-14-4-7-18(10)13(20)9-2-3-11(16-9)19(21)22;/h2-3,5-6,10,14,16H,4,7-8H2,1H3;1H |
| InChIKey | DIZXAJNEMDWIPU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|