C16H20ClN5O3 — CID 120879001
[2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-methyl-5-nitrophenyl)methanone;hydrochloride (PubChem CID 120879001) has the molecular formula C16H20ClN5O3 and a molecular weight of 365.82 g/mol. Its IUPAC name is [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-methyl-5-nitrophenyl)methanone;hydrochloride.
| Compound Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-methyl-5-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120879001 |
| Molecular Formula | C16H20ClN5O3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-methyl-5-nitrophenyl)methanone;hydrochloride |
| SMILES | Cc1cc(C(=O)N2CCNCC2c2nccn2C)cc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C16H19N5O3.ClH/c1-11-7-12(9-13(8-11)21(23)24)16(22)20-6-3-17-10-14(20)15-18-4-5-19(15)2;/h4-5,7-9,14,17H,3,6,10H2,1-2H3;1H |
| InChIKey | CUKIMURXBWPPIG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|