C14H19Cl2N5O — CID 120878927
[2-(1-methylimidazol-2-yl)piperazin-1-yl]-pyridin-3-ylmethanone;dihydrochloride (PubChem CID 120878927) has the molecular formula C14H19Cl2N5O and a molecular weight of 344.25 g/mol. Its IUPAC name is [2-(1-methylimidazol-2-yl)piperazin-1-yl]-pyridin-3-ylmethanone;dihydrochloride.
| Compound Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-pyridin-3-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 120878927 |
| Molecular Formula | C14H19Cl2N5O |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-pyridin-3-ylmethanone;dihydrochloride |
| SMILES | Cl.Cl.Cn1ccnc1C1CNCCN1C(=O)c1cccnc1 |
| InChI | InChI=1S/C14H17N5O.2ClH/c1-18-7-6-17-13(18)12-10-16-5-8-19(12)14(20)11-3-2-4-15-9-11;;/h2-4,6-7,9,12,16H,5,8,10H2,1H3;2*1H |
| InChIKey | ARPLSCFTUGVBDV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |