C18H21ClN6O — CID 120879403
[2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-pyrazol-1-ylphenyl)methanone;hydrochloride (PubChem CID 120879403) has the molecular formula C18H21ClN6O and a molecular weight of 372.86 g/mol. Its IUPAC name is [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-pyrazol-1-ylphenyl)methanone;hydrochloride.
| Compound Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-pyrazol-1-ylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120879403 |
| Molecular Formula | C18H21ClN6O |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(3-pyrazol-1-ylphenyl)methanone;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1C(=O)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H20N6O.ClH/c1-22-10-8-20-17(22)16-13-19-7-11-23(16)18(25)14-4-2-5-15(12-14)24-9-3-6-21-24;/h2-6,8-10,12,16,19H,7,11,13H2,1H3;1H |
| InChIKey | CHKUQMBNBYRNLY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |