C18H25ClN4O — CID 120877871
[2-(1-methylimidazol-2-yl)piperazin-1-yl]-(4-propylphenyl)methanone;hydrochloride (PubChem CID 120877871) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(4-propylphenyl)methanone;hydrochloride.
| Compound Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(4-propylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120877871 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [2-(1-methylimidazol-2-yl)piperazin-1-yl]-(4-propylphenyl)methanone;hydrochloride |
| SMILES | CCCc1ccc(C(=O)N2CCNCC2c2nccn2C)cc1.Cl |
| InChI | InChI=1S/C18H24N4O.ClH/c1-3-4-14-5-7-15(8-6-14)18(23)22-12-9-19-13-16(22)17-20-10-11-21(17)2;/h5-8,10-11,16,19H,3-4,9,12-13H2,1-2H3;1H |
| InChIKey | FNPINYQEMJYHNL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |