C20H23N5O3 — CID 120880036
3-[[4-[2-(1-methylimidazol-2-yl)piperazine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 120880036) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-[[4-[2-(1-methylimidazol-2-yl)piperazine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-[2-(1-methylimidazol-2-yl)piperazine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 120880036 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-[[4-[2-(1-methylimidazol-2-yl)piperazine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | Cn1ccnc1C1CNCCN1C(=O)c1ccc(CC2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-24-8-7-22-18(24)16-12-21-6-9-25(16)20(28)14-4-2-13(3-5-14)10-15-11-17(26)23-19(15)27/h2-5,7-8,15-16,21H,6,9-12H2,1H3,(H,23,26,27) |
| InChIKey | RWTUBYUGDCMZBR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|