C20H20F2N2O4S — CID 43059571
[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-(4-prop-2-enoxyphenyl)methanone (PubChem CID 43059571) has the molecular formula C20H20F2N2O4S and a molecular weight of 422.45 g/mol. Its IUPAC name is [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-(4-prop-2-enoxyphenyl)methanone.
| Compound Name | [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-(4-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 43059571 |
| Molecular Formula | C20H20F2N2O4S |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-(4-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1ccc(C(=O)N2CCN(S(=O)(=O)c3c(F)cccc3F)CC2)cc1 |
| InChI | InChI=1S/C20H20F2N2O4S/c1-2-14-28-16-8-6-15(7-9-16)20(25)23-10-12-24(13-11-23)29(26,27)19-17(21)4-3-5-18(19)22/h2-9H,1,10-14H2 |
| InChIKey | CMVOPPLJXZMHMN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|