C18H22N3O3S+ — CID 7040269
4-(4-methylpiperazin-4-ium-1-carbonyl)-N-phenylbenzenesulfonamide (PubChem CID 7040269) has the molecular formula C18H22N3O3S+ and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-(4-methylpiperazin-4-ium-1-carbonyl)-N-phenylbenzenesulfonamide.
| Compound Name | 4-(4-methylpiperazin-4-ium-1-carbonyl)-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 7040269 |
| Molecular Formula | C18H22N3O3S+ |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-(4-methylpiperazin-4-ium-1-carbonyl)-N-phenylbenzenesulfonamide |
| SMILES | C[NH+]1CCN(C(=O)c2ccc(S(=O)(=O)Nc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C18H21N3O3S/c1-20-11-13-21(14-12-20)18(22)15-7-9-17(10-8-15)25(23,24)19-16-5-3-2-4-6-16/h2-10,19H,11-14H2,1H3/p+1 |
| InChIKey | RGYWWDAZFGCLFC-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |