C23H31N3O3S — CID 55976243
4-[4-(3,3-dimethylbutyl)piperazine-1-carbonyl]-N-phenylbenzenesulfonamide (PubChem CID 55976243) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 4-[4-(3,3-dimethylbutyl)piperazine-1-carbonyl]-N-phenylbenzenesulfonamide.
| Compound Name | 4-[4-(3,3-dimethylbutyl)piperazine-1-carbonyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 55976243 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 4-[4-(3,3-dimethylbutyl)piperazine-1-carbonyl]-N-phenylbenzenesulfonamide |
| SMILES | CC(C)(C)CCN1CCN(C(=O)c2ccc(S(=O)(=O)Nc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H31N3O3S/c1-23(2,3)13-14-25-15-17-26(18-16-25)22(27)19-9-11-21(12-10-19)30(28,29)24-20-7-5-4-6-8-20/h4-12,24H,13-18H2,1-3H3 |
| InChIKey | AUUPCSJIQIRTHE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |