C19H21N3O5S — CID 108782929
4-[[4-(4-methylpiperazine-1-carbonyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 108782929) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[[4-(4-methylpiperazine-1-carbonyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[4-(4-methylpiperazine-1-carbonyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 108782929 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-[[4-(4-methylpiperazine-1-carbonyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | CN1CCN(C(=O)c2ccc(NS(=O)(=O)c3ccc(C(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C19H21N3O5S/c1-21-10-12-22(13-11-21)18(23)14-2-6-16(7-3-14)20-28(26,27)17-8-4-15(5-9-17)19(24)25/h2-9,20H,10-13H2,1H3,(H,24,25) |
| InChIKey | GKNQUAIOYXSKKU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |