C23H30N4O3S — CID 86958237
N-[4-[4-(1-methylpiperidin-3-yl)piperazine-1-carbonyl]phenyl]benzenesulfonamide (PubChem CID 86958237) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is N-[4-[4-(1-methylpiperidin-3-yl)piperazine-1-carbonyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[4-(1-methylpiperidin-3-yl)piperazine-1-carbonyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86958237 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[4-[4-(1-methylpiperidin-3-yl)piperazine-1-carbonyl]phenyl]benzenesulfonamide |
| SMILES | CN1CCCC(N2CCN(C(=O)c3ccc(NS(=O)(=O)c4ccccc4)cc3)CC2)C1 |
| InChI | InChI=1S/C23H30N4O3S/c1-25-13-5-6-21(18-25)26-14-16-27(17-15-26)23(28)19-9-11-20(12-10-19)24-31(29,30)22-7-3-2-4-8-22/h2-4,7-12,21,24H,5-6,13-18H2,1H3 |
| InChIKey | LUAQGVOSYDAFKF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |