C24H31N5O2 — CID 86958381
1-[4-[4-(1-methylpiperidin-3-yl)piperazine-1-carbonyl]phenyl]-3-phenylurea (PubChem CID 86958381) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-[4-[4-(1-methylpiperidin-3-yl)piperazine-1-carbonyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[4-(1-methylpiperidin-3-yl)piperazine-1-carbonyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 86958381 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-[4-[4-(1-methylpiperidin-3-yl)piperazine-1-carbonyl]phenyl]-3-phenylurea |
| SMILES | CN1CCCC(N2CCN(C(=O)c3ccc(NC(=O)Nc4ccccc4)cc3)CC2)C1 |
| InChI | InChI=1S/C24H31N5O2/c1-27-13-5-8-22(18-27)28-14-16-29(17-15-28)23(30)19-9-11-21(12-10-19)26-24(31)25-20-6-3-2-4-7-20/h2-4,6-7,9-12,22H,5,8,13-18H2,1H3,(H2,25,26,31) |
| InChIKey | URTJNEUMRSDLPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |