C21H30N4O2 — CID 118779622
N-[3-(4-methylpiperidine-1-carbonyl)phenyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 118779622) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[3-(4-methylpiperidine-1-carbonyl)phenyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-[3-(4-methylpiperidine-1-carbonyl)phenyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118779622 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-[3-(4-methylpiperidine-1-carbonyl)phenyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC1CCN(C(=O)c2cccc(NC(=O)N3CCN4CCCC4C3)c2)CC1 |
| InChI | InChI=1S/C21H30N4O2/c1-16-7-10-24(11-8-16)20(26)17-4-2-5-18(14-17)22-21(27)25-13-12-23-9-3-6-19(23)15-25/h2,4-5,14,16,19H,3,6-13,15H2,1H3,(H,22,27) |
| InChIKey | DQBZNLGEWFWWKF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |