C14H21Cl2N3O — CID 119881540
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-aminophenyl)methanone;dihydrochloride (PubChem CID 119881540) has the molecular formula C14H21Cl2N3O and a molecular weight of 318.25 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-aminophenyl)methanone;dihydrochloride.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-aminophenyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119881540 |
| Molecular Formula | C14H21Cl2N3O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-aminophenyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(C(=O)N2CCN3CCCC3C2)c1 |
| InChI | InChI=1S/C14H19N3O.2ClH/c15-12-4-1-3-11(9-12)14(18)17-8-7-16-6-2-5-13(16)10-17;;/h1,3-4,9,13H,2,5-8,10,15H2;2*1H |
| InChIKey | XJHTYFLOKWMVNZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|