C18H21N5O — CID 125158709
[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(6-aminopyrimidin-4-yl)phenyl]methanone (PubChem CID 125158709) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(6-aminopyrimidin-4-yl)phenyl]methanone.
| Compound Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(6-aminopyrimidin-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 125158709 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(6-aminopyrimidin-4-yl)phenyl]methanone |
| SMILES | Nc1cc(-c2cccc(C(=O)N3CCN4CCC[C@H]4C3)c2)ncn1 |
| InChI | InChI=1S/C18H21N5O/c19-17-10-16(20-12-21-17)13-3-1-4-14(9-13)18(24)23-8-7-22-6-2-5-15(22)11-23/h1,3-4,9-10,12,15H,2,5-8,11H2,(H2,19,20,21)/t15-/m0/s1 |
| InChIKey | SVMDNRSCDAENBW-HNNXBMFYSA-N |
| XLogP | 1.65 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |