C21H20ClN3O — CID 126451298
4-[3-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]-2-chlorobenzonitrile (PubChem CID 126451298) has the molecular formula C21H20ClN3O and a molecular weight of 365.86 g/mol. Its IUPAC name is 4-[3-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]-2-chlorobenzonitrile.
| Compound Name | 4-[3-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 126451298 |
| Molecular Formula | C21H20ClN3O |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 4-[3-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]-2-chlorobenzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(C(=O)N3CCN4CCC[C@@H]4C3)c2)cc1Cl |
| InChI | InChI=1S/C21H20ClN3O/c22-20-12-16(6-7-18(20)13-23)15-3-1-4-17(11-15)21(26)25-10-9-24-8-2-5-19(24)14-25/h1,3-4,6-7,11-12,19H,2,5,8-10,14H2/t19-/m1/s1 |
| InChIKey | MPOVBCOLOAJPQP-LJQANCHMSA-N |
| XLogP | 3.80 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |