C21H24N2O — CID 99987199
[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[4-(2-methylphenyl)phenyl]methanone (PubChem CID 99987199) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[4-(2-methylphenyl)phenyl]methanone.
| Compound Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[4-(2-methylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 99987199 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[4-(2-methylphenyl)phenyl]methanone |
| SMILES | Cc1ccccc1-c1ccc(C(=O)N2CCN3CCC[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H24N2O/c1-16-5-2-3-7-20(16)17-8-10-18(11-9-17)21(24)23-14-13-22-12-4-6-19(22)15-23/h2-3,5,7-11,19H,4,6,12-15H2,1H3/t19-/m0/s1 |
| InChIKey | GMYDQFFDXBCIFO-IBGZPJMESA-N |
| XLogP | 3.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |