C21H21F3N2O — CID 126425615
[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[4-[2-(trifluoromethyl)phenyl]phenyl]methanone (PubChem CID 126425615) has the molecular formula C21H21F3N2O and a molecular weight of 374.41 g/mol. Its IUPAC name is [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[4-[2-(trifluoromethyl)phenyl]phenyl]methanone.
| Compound Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[4-[2-(trifluoromethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 126425615 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[4-[2-(trifluoromethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2C(F)(F)F)cc1)N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C21H21F3N2O/c22-21(23,24)19-6-2-1-5-18(19)15-7-9-16(10-8-15)20(27)26-13-12-25-11-3-4-17(25)14-26/h1-2,5-10,17H,3-4,11-14H2/t17-/m0/s1 |
| InChIKey | JLKREWCSWGORTC-KRWDZBQOSA-N |
| XLogP | 4.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |