C22H23F3N4O3 — CID 67992719
1-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-2-hydroxyphenyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 67992719) has the molecular formula C22H23F3N4O3 and a molecular weight of 448.45 g/mol. Its IUPAC name is 1-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-2-hydroxyphenyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-2-hydroxyphenyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67992719 |
| Molecular Formula | C22H23F3N4O3 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-2-hydroxyphenyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)Nc1cccc(C(=O)N2CCN3CCCC3C2)c1O |
| InChI | InChI=1S/C22H23F3N4O3/c23-22(24,25)16-7-1-2-8-17(16)26-21(32)27-18-9-3-6-15(19(18)30)20(31)29-12-11-28-10-4-5-14(28)13-29/h1-3,6-9,14,30H,4-5,10-13H2,(H2,26,27,32) |
| InChIKey | BKKAWEAWXPVVEQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|