C21H23BrN4O3 — CID 67992748
1-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-2-hydroxyphenyl]-3-(2-bromophenyl)urea (PubChem CID 67992748) has the molecular formula C21H23BrN4O3 and a molecular weight of 459.34 g/mol. Its IUPAC name is 1-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-2-hydroxyphenyl]-3-(2-bromophenyl)urea.
| Compound Name | 1-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-2-hydroxyphenyl]-3-(2-bromophenyl)urea |
|---|---|
| PubChem CID | 67992748 |
| Molecular Formula | C21H23BrN4O3 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 1-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-2-hydroxyphenyl]-3-(2-bromophenyl)urea |
| SMILES | O=C(Nc1ccccc1Br)Nc1cccc(C(=O)N2CCN3CCCC3C2)c1O |
| InChI | InChI=1S/C21H23BrN4O3/c22-16-7-1-2-8-17(16)23-21(29)24-18-9-3-6-15(19(18)27)20(28)26-12-11-25-10-4-5-14(25)13-26/h1-3,6-9,14,27H,4-5,10-13H2,(H2,23,24,29) |
| InChIKey | SYWUOZGAKHXRAL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|