C23H27N3O2 — CID 126450765
2-[4-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]phenyl]-N-methylacetamide (PubChem CID 126450765) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[4-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]phenyl]-N-methylacetamide.
| Compound Name | 2-[4-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 126450765 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[4-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]phenyl]phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccc(-c2ccc(C(=O)N3CCN4CCC[C@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-24-22(27)15-17-4-6-18(7-5-17)19-8-10-20(11-9-19)23(28)26-14-13-25-12-2-3-21(25)16-26/h4-11,21H,2-3,12-16H2,1H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | ZRBFLEJUXLYFQA-NRFANRHFSA-N |
| XLogP | 2.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |