C14H18FN3O — CID 61107906
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-amino-4-fluorophenyl)methanone (PubChem CID 61107906) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-amino-4-fluorophenyl)methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-amino-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 61107906 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(3-amino-4-fluorophenyl)methanone |
| SMILES | Nc1cc(C(=O)N2CCN3CCCC3C2)ccc1F |
| InChI | InChI=1S/C14H18FN3O/c15-12-4-3-10(8-13(12)16)14(19)18-7-6-17-5-1-2-11(17)9-18/h3-4,8,11H,1-2,5-7,9,16H2 |
| InChIKey | MIORIPVJIPAQBJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|