C14H17F2N3O — CID 61109997
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(5-amino-2,4-difluorophenyl)methanone (PubChem CID 61109997) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(5-amino-2,4-difluorophenyl)methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(5-amino-2,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 61109997 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(5-amino-2,4-difluorophenyl)methanone |
| SMILES | Nc1cc(C(=O)N2CCN3CCCC3C2)c(F)cc1F |
| InChI | InChI=1S/C14H17F2N3O/c15-11-7-12(16)13(17)6-10(11)14(20)19-5-4-18-3-1-2-9(18)8-19/h6-7,9H,1-5,8,17H2 |
| InChIKey | HBKCNGDKEUNDTQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|