C15H19BrFN3O — CID 63168386
(5-amino-2-bromo-4-fluorophenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone (PubChem CID 63168386) has the molecular formula C15H19BrFN3O and a molecular weight of 356.24 g/mol. Its IUPAC name is (5-amino-2-bromo-4-fluorophenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone.
| Compound Name | (5-amino-2-bromo-4-fluorophenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 63168386 |
| Molecular Formula | C15H19BrFN3O |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (5-amino-2-bromo-4-fluorophenyl)-(3-pyrrolidin-1-ylpyrrolidin-1-yl)methanone |
| SMILES | Nc1cc(C(=O)N2CCC(N3CCCC3)C2)c(Br)cc1F |
| InChI | InChI=1S/C15H19BrFN3O/c16-12-8-13(17)14(18)7-11(12)15(21)20-6-3-10(9-20)19-4-1-2-5-19/h7-8,10H,1-6,9,18H2 |
| InChIKey | OTISBQOIFODTTI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|